C19H29NO — CID 114377127
N-[(3-tert-butyl-7-methyl-4-propan-2-yl-1-benzofuran-2-yl)methyl]ethanamine (PubChem CID 114377127) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is N-[(3-tert-butyl-7-methyl-4-propan-2-yl-1-benzofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[(3-tert-butyl-7-methyl-4-propan-2-yl-1-benzofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114377127 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | N-[(3-tert-butyl-7-methyl-4-propan-2-yl-1-benzofuran-2-yl)methyl]ethanamine |
| SMILES | CCNCc1oc2c(C)ccc(C(C)C)c2c1C(C)(C)C |
| InChI | InChI=1S/C19H29NO/c1-8-20-11-15-17(19(5,6)7)16-14(12(2)3)10-9-13(4)18(16)21-15/h9-10,12,20H,8,11H2,1-7H3 |
| InChIKey | KVHMTQHXKMBQNI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |