C20H22O — CID 100935379
4,6-dimethyl-1-propan-2-yl-9-prop-1-en-2-yldibenzofuran (PubChem CID 100935379) has the molecular formula C20H22O and a molecular weight of 278.40 g/mol. Its IUPAC name is 4,6-dimethyl-1-propan-2-yl-9-prop-1-en-2-yldibenzofuran.
| Compound Name | 4,6-dimethyl-1-propan-2-yl-9-prop-1-en-2-yldibenzofuran |
|---|---|
| PubChem CID | 100935379 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4,6-dimethyl-1-propan-2-yl-9-prop-1-en-2-yldibenzofuran |
| SMILES | C=C(C)c1ccc(C)c2oc3c(C)ccc(C(C)C)c3c12 |
| InChI | InChI=1S/C20H22O/c1-11(2)15-9-7-13(5)19-17(15)18-16(12(3)4)10-8-14(6)20(18)21-19/h7-10,12H,1H2,2-6H3 |
| InChIKey | MGIXTVBBARMXGP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |