C16H20ClNO — CID 114377233
N-[(7-chloro-3-cyclopropyl-5-methyl-1-benzofuran-2-yl)methyl]propan-2-amine (PubChem CID 114377233) has the molecular formula C16H20ClNO and a molecular weight of 277.80 g/mol. Its IUPAC name is N-[(7-chloro-3-cyclopropyl-5-methyl-1-benzofuran-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(7-chloro-3-cyclopropyl-5-methyl-1-benzofuran-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 114377233 |
| Molecular Formula | C16H20ClNO |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(7-chloro-3-cyclopropyl-5-methyl-1-benzofuran-2-yl)methyl]propan-2-amine |
| SMILES | Cc1cc(Cl)c2oc(CNC(C)C)c(C3CC3)c2c1 |
| InChI | InChI=1S/C16H20ClNO/c1-9(2)18-8-14-15(11-4-5-11)12-6-10(3)7-13(17)16(12)19-14/h6-7,9,11,18H,4-5,8H2,1-3H3 |
| InChIKey | ZATVFGTWCKWAAF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |