C15H16BrCl2NO — CID 107662984
N-[(5-bromo-4,7-dichloro-3-cyclopropyl-1-benzofuran-2-yl)methyl]propan-2-amine (PubChem CID 107662984) has the molecular formula C15H16BrCl2NO and a molecular weight of 377.11 g/mol. Its IUPAC name is N-[(5-bromo-4,7-dichloro-3-cyclopropyl-1-benzofuran-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(5-bromo-4,7-dichloro-3-cyclopropyl-1-benzofuran-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 107662984 |
| Molecular Formula | C15H16BrCl2NO |
| Molecular Weight | 377.11 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | N-[(5-bromo-4,7-dichloro-3-cyclopropyl-1-benzofuran-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1oc2c(Cl)cc(Br)c(Cl)c2c1C1CC1 |
| InChI | InChI=1S/C15H16BrCl2NO/c1-7(2)19-6-11-12(8-3-4-8)13-14(18)9(16)5-10(17)15(13)20-11/h5,7-8,19H,3-4,6H2,1-2H3 |
| InChIKey | IOBYKHLMDZCIBS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.11 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|