C13H12BrClFNO — CID 114042910
1-(7-bromo-5-chloro-3-cyclopropyl-4-fluoro-1-benzofuran-2-yl)-N-methylmethanamine (PubChem CID 114042910) has the molecular formula C13H12BrClFNO and a molecular weight of 332.60 g/mol. Its IUPAC name is 1-(7-bromo-5-chloro-3-cyclopropyl-4-fluoro-1-benzofuran-2-yl)-N-methylmethanamine.
| Compound Name | 1-(7-bromo-5-chloro-3-cyclopropyl-4-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114042910 |
| Molecular Formula | C13H12BrClFNO |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-(7-bromo-5-chloro-3-cyclopropyl-4-fluoro-1-benzofuran-2-yl)-N-methylmethanamine |
| SMILES | CNCc1oc2c(Br)cc(Cl)c(F)c2c1C1CC1 |
| InChI | InChI=1S/C13H12BrClFNO/c1-17-5-9-10(6-2-3-6)11-12(16)8(15)4-7(14)13(11)18-9/h4,6,17H,2-3,5H2,1H3 |
| InChIKey | NQMBIYSXVRBSGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|