C17H24ClNS — CID 114377810
N-[(3-tert-butyl-7-chloro-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine (PubChem CID 114377810) has the molecular formula C17H24ClNS and a molecular weight of 309.91 g/mol. Its IUPAC name is N-[(3-tert-butyl-7-chloro-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(3-tert-butyl-7-chloro-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114377810 |
| Molecular Formula | C17H24ClNS |
| Molecular Weight | 309.91 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[(3-tert-butyl-7-chloro-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1sc2c(Cl)cccc2c1C(C)(C)C |
| InChI | InChI=1S/C17H24ClNS/c1-11(2)9-19-10-14-15(17(3,4)5)12-7-6-8-13(18)16(12)20-14/h6-8,11,19H,9-10H2,1-5H3 |
| InChIKey | LTGGGFFHPSXDAM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |