C16H22FNS — CID 114378033
N-[(5-fluoro-3-propan-2-yl-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine (PubChem CID 114378033) has the molecular formula C16H22FNS and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(5-fluoro-3-propan-2-yl-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine.
| Compound Name | N-[(5-fluoro-3-propan-2-yl-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114378033 |
| Molecular Formula | C16H22FNS |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(5-fluoro-3-propan-2-yl-1-benzothiophen-2-yl)methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1sc2ccc(F)cc2c1C(C)C |
| InChI | InChI=1S/C16H22FNS/c1-10(2)8-18-9-15-16(11(3)4)13-7-12(17)5-6-14(13)19-15/h5-7,10-11,18H,8-9H2,1-4H3 |
| InChIKey | VRSVMRBYIRDHSH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |