C9H5BrF2S — CID 131223463
2-(bromomethyl)-3,5-difluoro-1-benzothiophene (PubChem CID 131223463) has the molecular formula C9H5BrF2S and a molecular weight of 263.11 g/mol. Its IUPAC name is 2-(bromomethyl)-3,5-difluoro-1-benzothiophene.
| Compound Name | 2-(bromomethyl)-3,5-difluoro-1-benzothiophene |
|---|---|
| PubChem CID | 131223463 |
| Molecular Formula | C9H5BrF2S |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 261.93 |
| IUPAC Name | 2-(bromomethyl)-3,5-difluoro-1-benzothiophene |
| SMILES | Fc1ccc2sc(CBr)c(F)c2c1 |
| InChI | InChI=1S/C9H5BrF2S/c10-4-8-9(12)6-3-5(11)1-2-7(6)13-8/h1-3H,4H2 |
| InChIKey | XPVRBXOZTYVWSB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|