C13H15BrN4O2 — CID 114382281
[1-[(4-bromo-2-nitrophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methanamine (PubChem CID 114382281) has the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. Its IUPAC name is [1-[(4-bromo-2-nitrophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methanamine.
| Compound Name | [1-[(4-bromo-2-nitrophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 114382281 |
| Molecular Formula | C13H15BrN4O2 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [1-[(4-bromo-2-nitrophenyl)methyl]-3,5-dimethylpyrazol-4-yl]methanamine |
| SMILES | Cc1nn(Cc2ccc(Br)cc2[N+](=O)[O-])c(C)c1CN |
| InChI | InChI=1S/C13H15BrN4O2/c1-8-12(6-15)9(2)17(16-8)7-10-3-4-11(14)5-13(10)18(19)20/h3-5H,6-7,15H2,1-2H3 |
| InChIKey | AQJQDXXBURPDKP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|