C13H13ClFN3O2 — CID 107350414
4-(chloromethyl)-1-[(2-fluoro-3-nitrophenyl)methyl]-3,5-dimethylpyrazole (PubChem CID 107350414) has the molecular formula C13H13ClFN3O2 and a molecular weight of 297.72 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(2-fluoro-3-nitrophenyl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 4-(chloromethyl)-1-[(2-fluoro-3-nitrophenyl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 107350414 |
| Molecular Formula | C13H13ClFN3O2 |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-(chloromethyl)-1-[(2-fluoro-3-nitrophenyl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1nn(Cc2cccc([N+](=O)[O-])c2F)c(C)c1CCl |
| InChI | InChI=1S/C13H13ClFN3O2/c1-8-11(6-14)9(2)17(16-8)7-10-4-3-5-12(13(10)15)18(19)20/h3-5H,6-7H2,1-2H3 |
| InChIKey | WCHIKZATHWUUIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|