C16H15BrN2O2 — CID 114382796
1-[(4-bromo-2-nitrophenyl)methyl]-2,3-dihydroinden-1-amine (PubChem CID 114382796) has the molecular formula C16H15BrN2O2 and a molecular weight of 347.21 g/mol. Its IUPAC name is 1-[(4-bromo-2-nitrophenyl)methyl]-2,3-dihydroinden-1-amine.
| Compound Name | 1-[(4-bromo-2-nitrophenyl)methyl]-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 114382796 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 1-[(4-bromo-2-nitrophenyl)methyl]-2,3-dihydroinden-1-amine |
| SMILES | NC1(Cc2ccc(Br)cc2[N+](=O)[O-])CCc2ccccc21 |
| InChI | InChI=1S/C16H15BrN2O2/c17-13-6-5-12(15(9-13)19(20)21)10-16(18)8-7-11-3-1-2-4-14(11)16/h1-6,9H,7-8,10,18H2 |
| InChIKey | IPQYQOXUZPHWDL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|