C16H15FN2O2 — CID 107353722
1-[(2-fluoro-3-nitrophenyl)methyl]-2,3-dihydroinden-1-amine (PubChem CID 107353722) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 1-[(2-fluoro-3-nitrophenyl)methyl]-2,3-dihydroinden-1-amine.
| Compound Name | 1-[(2-fluoro-3-nitrophenyl)methyl]-2,3-dihydroinden-1-amine |
|---|---|
| PubChem CID | 107353722 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 1-[(2-fluoro-3-nitrophenyl)methyl]-2,3-dihydroinden-1-amine |
| SMILES | NC1(Cc2cccc([N+](=O)[O-])c2F)CCc2ccccc21 |
| InChI | InChI=1S/C16H15FN2O2/c17-15-12(5-3-7-14(15)19(20)21)10-16(18)9-8-11-4-1-2-6-13(11)16/h1-7H,8-10,18H2 |
| InChIKey | GOSNKICFPGDZPQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|