C16H23FN2O2 — CID 107353703
[4-ethyl-1-[(2-fluoro-3-nitrophenyl)methyl]cyclohexyl]methanamine (PubChem CID 107353703) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is [4-ethyl-1-[(2-fluoro-3-nitrophenyl)methyl]cyclohexyl]methanamine.
| Compound Name | [4-ethyl-1-[(2-fluoro-3-nitrophenyl)methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 107353703 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | [4-ethyl-1-[(2-fluoro-3-nitrophenyl)methyl]cyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)(Cc2cccc([N+](=O)[O-])c2F)CC1 |
| InChI | InChI=1S/C16H23FN2O2/c1-2-12-6-8-16(11-18,9-7-12)10-13-4-3-5-14(15(13)17)19(20)21/h3-5,12H,2,6-11,18H2,1H3 |
| InChIKey | BOUVMTWPPIBMAR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|