C16H24ClN — CID 65392864
[1-[(3-chlorophenyl)methyl]-4-ethylcyclohexyl]methanamine (PubChem CID 65392864) has the molecular formula C16H24ClN and a molecular weight of 265.83 g/mol. Its IUPAC name is [1-[(3-chlorophenyl)methyl]-4-ethylcyclohexyl]methanamine.
| Compound Name | [1-[(3-chlorophenyl)methyl]-4-ethylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 65392864 |
| Molecular Formula | C16H24ClN |
| Molecular Weight | 265.83 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | [1-[(3-chlorophenyl)methyl]-4-ethylcyclohexyl]methanamine |
| SMILES | CCC1CCC(CN)(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H24ClN/c1-2-13-6-8-16(12-18,9-7-13)11-14-4-3-5-15(17)10-14/h3-5,10,13H,2,6-9,11-12,18H2,1H3 |
| InChIKey | FESGBDNZVVFGTB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.83 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |