C10H14N4O2 — CID 114383008
6-amino-5-(but-3-yn-2-ylamino)-1-ethylpyrimidine-2,4-dione (PubChem CID 114383008) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-amino-5-(but-3-yn-2-ylamino)-1-ethylpyrimidine-2,4-dione.
| Compound Name | 6-amino-5-(but-3-yn-2-ylamino)-1-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 114383008 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 6-amino-5-(but-3-yn-2-ylamino)-1-ethylpyrimidine-2,4-dione |
| SMILES | C#CC(C)Nc1c(N)n(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N4O2/c1-4-6(3)12-7-8(11)14(5-2)10(16)13-9(7)15/h1,6,12H,5,11H2,2-3H3,(H,13,15,16) |
| InChIKey | PTRDPSCILPCNIS-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|