C12H16N4O2S — CID 62840509
6-amino-1-ethyl-5-(1-thiophen-3-ylethylamino)pyrimidine-2,4-dione (PubChem CID 62840509) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 6-amino-1-ethyl-5-(1-thiophen-3-ylethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-ethyl-5-(1-thiophen-3-ylethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 62840509 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 6-amino-1-ethyl-5-(1-thiophen-3-ylethylamino)pyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(NC(C)c2ccsc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H16N4O2S/c1-3-16-10(13)9(11(17)15-12(16)18)14-7(2)8-4-5-19-6-8/h4-7,14H,3,13H2,1-2H3,(H,15,17,18) |
| InChIKey | DJNWMTPQFFPPRA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |