C11H14N4O2S — CID 60966171
6-amino-1-ethyl-5-(thiophen-3-ylmethylamino)pyrimidine-2,4-dione (PubChem CID 60966171) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is 6-amino-1-ethyl-5-(thiophen-3-ylmethylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-ethyl-5-(thiophen-3-ylmethylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60966171 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-amino-1-ethyl-5-(thiophen-3-ylmethylamino)pyrimidine-2,4-dione |
| SMILES | CCn1c(N)c(NCc2ccsc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N4O2S/c1-2-15-9(12)8(10(16)14-11(15)17)13-5-7-3-4-18-6-7/h3-4,6,13H,2,5,12H2,1H3,(H,14,16,17) |
| InChIKey | HUABBABPTNJBRI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |