C10H18N2O4S — CID 114383110
ethyl 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetate (PubChem CID 114383110) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is ethyl 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetate.
| Compound Name | ethyl 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetate |
|---|---|
| PubChem CID | 114383110 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | ethyl 2-[cyclopropylsulfamoyl(prop-2-enyl)amino]acetate |
| SMILES | C=CCN(CC(=O)OCC)S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C10H18N2O4S/c1-3-7-12(8-10(13)16-4-2)17(14,15)11-9-5-6-9/h3,9,11H,1,4-8H2,2H3 |
| InChIKey | AMZRKMIXPSBZFA-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|