C11H22F2N2O — CID 114383560
N-(3-amino-2,2-difluoropropyl)-3,4,4-trimethylpentanamide (PubChem CID 114383560) has the molecular formula C11H22F2N2O and a molecular weight of 236.31 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-3,4,4-trimethylpentanamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-3,4,4-trimethylpentanamide |
|---|---|
| PubChem CID | 114383560 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-3,4,4-trimethylpentanamide |
| SMILES | CC(CC(=O)NCC(F)(F)CN)C(C)(C)C |
| InChI | InChI=1S/C11H22F2N2O/c1-8(10(2,3)4)5-9(16)15-7-11(12,13)6-14/h8H,5-7,14H2,1-4H3,(H,15,16) |
| InChIKey | KGBIFJYWFDNQOE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |