C5H13F2N3O2S — CID 114384014
1-amino-3-(dimethylsulfamoylamino)-2,2-difluoropropane (PubChem CID 114384014) has the molecular formula C5H13F2N3O2S and a molecular weight of 217.24 g/mol. Its IUPAC name is 1-amino-3-(dimethylsulfamoylamino)-2,2-difluoropropane.
| Compound Name | 1-amino-3-(dimethylsulfamoylamino)-2,2-difluoropropane |
|---|---|
| PubChem CID | 114384014 |
| Molecular Formula | C5H13F2N3O2S |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1-amino-3-(dimethylsulfamoylamino)-2,2-difluoropropane |
| SMILES | CN(C)S(=O)(=O)NCC(F)(F)CN |
| InChI | InChI=1S/C5H13F2N3O2S/c1-10(2)13(11,12)9-4-5(6,7)3-8/h9H,3-4,8H2,1-2H3 |
| InChIKey | IOWBVRDSVFELLZ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |