About ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate
ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate (PubChem CID 114384618) has the molecular formula C9H13F2N3O2
and a molecular weight of 233.22 g/mol. Its IUPAC name is ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate.
Analyze ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate?
The IUPAC name of ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate (CID 114384618) is ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate.
What is the SMILES notation for ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate?
The canonical SMILES for ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate is CCOC(=O)c1cncn1CC(F)(F)CN.
What is the InChIKey of ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate?
The InChIKey is UGLGQDJCPAJFBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O2/c1-2-16-8(15)7-3-13-6-14(7)5-9(10,11)4-12/h3,6H,2,4-5,12H2,1H3.
What are the key properties of ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate?
ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate has a molecular weight of 233.22 g/mol, XLogP of 0.65, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(3-amino-2,2-difluoropropyl)imidazole-4-carboxylate is sourced from PubChem (CID 114384618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).