C10H23N3O2S — CID 114384890
2-(2-piperidin-1-ylpropylamino)ethanesulfonamide (PubChem CID 114384890) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylpropylamino)ethanesulfonamide.
| Compound Name | 2-(2-piperidin-1-ylpropylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114384890 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(2-piperidin-1-ylpropylamino)ethanesulfonamide |
| SMILES | CC(CNCCS(N)(=O)=O)N1CCCCC1 |
| InChI | InChI=1S/C10H23N3O2S/c1-10(13-6-3-2-4-7-13)9-12-5-8-16(11,14)15/h10,12H,2-9H2,1H3,(H2,11,14,15) |
| InChIKey | DFEOMTKQWMHZTA-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|