C9H21N3O2S — CID 114385119
2-(2-pyrrolidin-1-ylpropylamino)ethanesulfonamide (PubChem CID 114385119) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-(2-pyrrolidin-1-ylpropylamino)ethanesulfonamide.
| Compound Name | 2-(2-pyrrolidin-1-ylpropylamino)ethanesulfonamide |
|---|---|
| PubChem CID | 114385119 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 2-(2-pyrrolidin-1-ylpropylamino)ethanesulfonamide |
| SMILES | CC(CNCCS(N)(=O)=O)N1CCCC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-9(12-5-2-3-6-12)8-11-4-7-15(10,13)14/h9,11H,2-8H2,1H3,(H2,10,13,14) |
| InChIKey | PXMKYMSSSUTEKF-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|