C7H11BrN4O3S — CID 114385927
N-[2-[(5-bromo-6-oxo-1H-pyridazin-4-yl)amino]ethyl]methanesulfonamide (PubChem CID 114385927) has the molecular formula C7H11BrN4O3S and a molecular weight of 311.16 g/mol. Its IUPAC name is N-[2-[(5-bromo-6-oxo-1H-pyridazin-4-yl)amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(5-bromo-6-oxo-1H-pyridazin-4-yl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 114385927 |
| Molecular Formula | C7H11BrN4O3S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | N-[2-[(5-bromo-6-oxo-1H-pyridazin-4-yl)amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1cn[nH]c(=O)c1Br |
| InChI | InChI=1S/C7H11BrN4O3S/c1-16(14,15)11-3-2-9-5-4-10-12-7(13)6(5)8/h4,11H,2-3H2,1H3,(H2,9,12,13) |
| InChIKey | CWWYQEUYAOZDIX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|