C13H17BrFNO3S — CID 114386523
4-bromo-2-fluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylbenzenesulfonamide (PubChem CID 114386523) has the molecular formula C13H17BrFNO3S and a molecular weight of 366.25 g/mol. Its IUPAC name is 4-bromo-2-fluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-bromo-2-fluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114386523 |
| Molecular Formula | C13H17BrFNO3S |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-bromo-2-fluoro-N-[(1-hydroxycyclopentyl)methyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC1(O)CCCC1)S(=O)(=O)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H17BrFNO3S/c1-16(9-13(17)6-2-3-7-13)20(18,19)12-5-4-10(14)8-11(12)15/h4-5,8,17H,2-3,6-7,9H2,1H3 |
| InChIKey | HJVCMXQBRXBNNH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |