C13H17ClFNO4S — CID 114951831
4-chloro-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzenesulfonamide (PubChem CID 114951831) has the molecular formula C13H17ClFNO4S and a molecular weight of 337.80 g/mol. Its IUPAC name is 4-chloro-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-chloro-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114951831 |
| Molecular Formula | C13H17ClFNO4S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-chloro-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC1(O)CCOCC1)S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFNO4S/c1-16(9-13(17)4-6-20-7-5-13)21(18,19)12-3-2-10(14)8-11(12)15/h2-3,8,17H,4-7,9H2,1H3 |
| InChIKey | GTNLKYGNPBRIDO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |