C12H17FN2O4S — CID 114951778
5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylpyridine-3-sulfonamide (PubChem CID 114951778) has the molecular formula C12H17FN2O4S and a molecular weight of 304.34 g/mol. Its IUPAC name is 5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylpyridine-3-sulfonamide.
| Compound Name | 5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114951778 |
| Molecular Formula | C12H17FN2O4S |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylpyridine-3-sulfonamide |
| SMILES | CN(CC1(O)CCOCC1)S(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C12H17FN2O4S/c1-15(9-12(16)2-4-19-5-3-12)20(17,18)11-6-10(13)7-14-8-11/h6-8,16H,2-5,9H2,1H3 |
| InChIKey | KETLCLRSNGOQIK-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |