C13H11N7O — CID 114386719
1-(4-aminophenyl)-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 114386719) has the molecular formula C13H11N7O and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-(4-aminophenyl)-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-aminophenyl)-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114386719 |
| Molecular Formula | C13H11N7O |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-(4-aminophenyl)-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | Nc1ccc(-n2ccc(C(=O)Nc3nccnn3)n2)cc1 |
| InChI | InChI=1S/C13H11N7O/c14-9-1-3-10(4-2-9)20-8-5-11(19-20)12(21)17-13-15-6-7-16-18-13/h1-8H,14H2,(H,15,17,18,21) |
| InChIKey | AFPMNJPVNNDKCF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|