C9H11N7O — CID 114386772
4-amino-1-ethyl-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide (PubChem CID 114386772) has the molecular formula C9H11N7O and a molecular weight of 233.23 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114386772 |
| Molecular Formula | C9H11N7O |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 4-amino-1-ethyl-N-(1,2,4-triazin-3-yl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)Nc2nccnn2)n1 |
| InChI | InChI=1S/C9H11N7O/c1-2-16-5-6(10)7(15-16)8(17)13-9-11-3-4-12-14-9/h3-5H,2,10H2,1H3,(H,11,13,14,17) |
| InChIKey | AQQNLPHFKHEDSO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |