C12H12Cl2N4O — CID 65469816
4-amino-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide (PubChem CID 65469816) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 4-amino-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-amino-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 65469816 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-amino-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)Nc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N4O/c1-2-18-6-9(15)11(17-18)12(19)16-10-7(13)4-3-5-8(10)14/h3-6H,2,15H2,1H3,(H,16,19) |
| InChIKey | STQVUEPEPGVNNZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |