C12H10BrCl2N3O — CID 19267283
4-bromo-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide (PubChem CID 19267283) has the molecular formula C12H10BrCl2N3O and a molecular weight of 363.04 g/mol. Its IUPAC name is 4-bromo-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19267283 |
| Molecular Formula | C12H10BrCl2N3O |
| Molecular Weight | 363.04 g/mol |
| Exact Mass | 360.94 |
| IUPAC Name | 4-bromo-N-(2,6-dichlorophenyl)-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)Nc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C12H10BrCl2N3O/c1-2-18-6-7(13)10(17-18)12(19)16-11-8(14)4-3-5-9(11)15/h3-6H,2H2,1H3,(H,16,19) |
| InChIKey | ADVGTOZVXBYLAH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |