C19H16BrN3O2 — CID 35325026
N-(2-benzoylphenyl)-4-bromo-1-ethylpyrazole-3-carboxamide (PubChem CID 35325026) has the molecular formula C19H16BrN3O2 and a molecular weight of 398.26 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-4-bromo-1-ethylpyrazole-3-carboxamide.
| Compound Name | N-(2-benzoylphenyl)-4-bromo-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 35325026 |
| Molecular Formula | C19H16BrN3O2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-(2-benzoylphenyl)-4-bromo-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)Nc2ccccc2C(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C19H16BrN3O2/c1-2-23-12-15(20)17(22-23)19(25)21-16-11-7-6-10-14(16)18(24)13-8-4-3-5-9-13/h3-12H,2H2,1H3,(H,21,25) |
| InChIKey | XLOCJDRVNZBBQX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |