C16H20BrN5O2 — CID 4582260
[2-[(4-bromo-1-ethylpyrazole-3-carbonyl)amino]phenyl]-tert-butylimino-oxidoazanium (PubChem CID 4582260) has the molecular formula C16H20BrN5O2 and a molecular weight of 394.27 g/mol. Its IUPAC name is [2-[(4-bromo-1-ethylpyrazole-3-carbonyl)amino]phenyl]-tert-butylimino-oxidoazanium.
| Compound Name | [2-[(4-bromo-1-ethylpyrazole-3-carbonyl)amino]phenyl]-tert-butylimino-oxidoazanium |
|---|---|
| PubChem CID | 4582260 |
| Molecular Formula | C16H20BrN5O2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | [2-[(4-bromo-1-ethylpyrazole-3-carbonyl)amino]phenyl]-tert-butylimino-oxidoazanium |
| SMILES | CCn1cc(Br)c(C(=O)Nc2ccccc2/[N+]([O-])=N/C(C)(C)C)n1 |
| InChI | InChI=1S/C16H20BrN5O2/c1-5-21-10-11(17)14(19-21)15(23)18-12-8-6-7-9-13(12)22(24)20-16(2,3)4/h6-10H,5H2,1-4H3,(H,18,23)/b22-20- |
| InChIKey | VLIIHLSTTHANMA-XDOYNYLZSA-N |
| XLogP | 4.31 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|