C14H16ClN5O — CID 114387285
2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-propylpyridine-4-carboxamide (PubChem CID 114387285) has the molecular formula C14H16ClN5O and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-propylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-propylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 114387285 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-chloro-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-propylpyridine-4-carboxamide |
| SMILES | CCCc1cc(C(=O)Nc2nnc(C)c(C)n2)cc(Cl)n1 |
| InChI | InChI=1S/C14H16ClN5O/c1-4-5-11-6-10(7-12(15)17-11)13(21)18-14-16-8(2)9(3)19-20-14/h6-7H,4-5H2,1-3H3,(H,16,18,20,21) |
| InChIKey | KOWSDKBAGDHARD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|