C12H11N5O — CID 114387742
N-(1,2,4-triazin-3-yl)-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 114387742) has the molecular formula C12H11N5O and a molecular weight of 241.25 g/mol. Its IUPAC name is N-(1,2,4-triazin-3-yl)-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-(1,2,4-triazin-3-yl)-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 114387742 |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(1,2,4-triazin-3-yl)-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | O=C(Nc1nccnn1)C1CNc2ccccc21 |
| InChI | InChI=1S/C12H11N5O/c18-11(16-12-13-5-6-15-17-12)9-7-14-10-4-2-1-3-8(9)10/h1-6,9,14H,7H2,(H,13,16,17,18) |
| InChIKey | ANMNUMQMCVNLMH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |