C10H15N5O — CID 114387894
2-piperidin-3-yl-N-(1,2,4-triazin-3-yl)acetamide (PubChem CID 114387894) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-piperidin-3-yl-N-(1,2,4-triazin-3-yl)acetamide.
| Compound Name | 2-piperidin-3-yl-N-(1,2,4-triazin-3-yl)acetamide |
|---|---|
| PubChem CID | 114387894 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-piperidin-3-yl-N-(1,2,4-triazin-3-yl)acetamide |
| SMILES | O=C(CC1CCCNC1)Nc1nccnn1 |
| InChI | InChI=1S/C10H15N5O/c16-9(6-8-2-1-3-11-7-8)14-10-12-4-5-13-15-10/h4-5,8,11H,1-3,6-7H2,(H,12,14,15,16) |
| InChIKey | YEDYSVYMHMXIJD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |