C12H17N5O3 — CID 114388651
3-[1-(1,2,4-triazin-3-ylcarbamoyl)piperidin-3-yl]propanoic acid (PubChem CID 114388651) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 3-[1-(1,2,4-triazin-3-ylcarbamoyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-(1,2,4-triazin-3-ylcarbamoyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 114388651 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-[1-(1,2,4-triazin-3-ylcarbamoyl)piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCN(C(=O)Nc2nccnn2)C1 |
| InChI | InChI=1S/C12H17N5O3/c18-10(19)4-3-9-2-1-7-17(8-9)12(20)15-11-13-5-6-14-16-11/h5-6,9H,1-4,7-8H2,(H,18,19)(H,13,15,16,20) |
| InChIKey | OTTKOKJZVPRTBF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |