C17H23N3O4 — CID 146096658
3-[1-[(4-carbamoyl-2-methylphenyl)carbamoyl]piperidin-3-yl]propanoic acid (PubChem CID 146096658) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-[1-[(4-carbamoyl-2-methylphenyl)carbamoyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[(4-carbamoyl-2-methylphenyl)carbamoyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 146096658 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-[1-[(4-carbamoyl-2-methylphenyl)carbamoyl]piperidin-3-yl]propanoic acid |
| SMILES | Cc1cc(C(N)=O)ccc1NC(=O)N1CCCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C17H23N3O4/c1-11-9-13(16(18)23)5-6-14(11)19-17(24)20-8-2-3-12(10-20)4-7-15(21)22/h5-6,9,12H,2-4,7-8,10H2,1H3,(H2,18,23)(H,19,24)(H,21,22) |
| InChIKey | LNIVBWBTKASFIS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |