C18H26N2O4 — CID 11439046
diethyl 1,2,3,4,6,7,8,9-octahydrophenazine-4a,9a-dicarboxylate (PubChem CID 11439046) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is diethyl 1,2,3,4,6,7,8,9-octahydrophenazine-4a,9a-dicarboxylate.
| Compound Name | diethyl 1,2,3,4,6,7,8,9-octahydrophenazine-4a,9a-dicarboxylate |
|---|---|
| PubChem CID | 11439046 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | diethyl 1,2,3,4,6,7,8,9-octahydrophenazine-4a,9a-dicarboxylate |
| SMILES | CCOC(=O)C12CCCCC1=NC1(C(=O)OCC)CCCCC1=N2 |
| InChI | InChI=1S/C18H26N2O4/c1-3-23-15(21)17-11-7-5-9-13(17)20-18(16(22)24-4-2)12-8-6-10-14(18)19-17/h3-12H2,1-2H3 |
| InChIKey | BCAATMHBCAMRRC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |