C10H17NO3 — CID 45089497
ethyl (1R,2E)-2-hydroxyimino-1-methylcyclohexane-1-carboxylate (PubChem CID 45089497) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is ethyl (1R,2E)-2-hydroxyimino-1-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2E)-2-hydroxyimino-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 45089497 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | ethyl (1R,2E)-2-hydroxyimino-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCCC/C1=N\O |
| InChI | InChI=1S/C10H17NO3/c1-3-14-9(12)10(2)7-5-4-6-8(10)11-13/h13H,3-7H2,1-2H3/b11-8+/t10-/m1/s1 |
| InChIKey | CHZMOGXAUUSINE-MXBGMFSPSA-N |
| XLogP | 1.96 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|