C11H19NO3 — CID 125476524
ethyl (1S,2Z)-2-methoxyimino-1-methylcyclohexane-1-carboxylate (PubChem CID 125476524) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl (1S,2Z)-2-methoxyimino-1-methylcyclohexane-1-carboxylate.
| Compound Name | ethyl (1S,2Z)-2-methoxyimino-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 125476524 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | ethyl (1S,2Z)-2-methoxyimino-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)CCCC/C1=N/OC |
| InChI | InChI=1S/C11H19NO3/c1-4-15-10(13)11(2)8-6-5-7-9(11)12-14-3/h4-8H2,1-3H3/b12-9-/t11-/m0/s1 |
| InChIKey | HFNOXCPPBOOPOJ-AWPPVZKDSA-N |
| XLogP | 2.13 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|