C20H25NO2S — CID 11439328
N-methyl-2-[(S)-[(1R)-4-methyl-1-phenylpentyl]sulfinyl]benzamide (PubChem CID 11439328) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-methyl-2-[(S)-[(1R)-4-methyl-1-phenylpentyl]sulfinyl]benzamide.
| Compound Name | N-methyl-2-[(S)-[(1R)-4-methyl-1-phenylpentyl]sulfinyl]benzamide |
|---|---|
| PubChem CID | 11439328 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-methyl-2-[(S)-[(1R)-4-methyl-1-phenylpentyl]sulfinyl]benzamide |
| SMILES | CNC(=O)c1ccccc1[S@@](=O)[C@H](CCC(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2S/c1-15(2)13-14-18(16-9-5-4-6-10-16)24(23)19-12-8-7-11-17(19)20(22)21-3/h4-12,15,18H,13-14H2,1-3H3,(H,21,22)/t18-,24+/m1/s1 |
| InChIKey | JRIWXJUQKFSQHQ-KOSHJBKYSA-N |
| XLogP | 4.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |