About 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one
2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one (PubChem CID 114393631) has the molecular formula C11H17F3N4O
and a molecular weight of 278.28 g/mol. Its IUPAC name is 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one |
| PubChem CID | 114393631 |
| Molecular Formula | C11H17F3N4O |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one |
| SMILES | CCCN(C)c1cnn(C(CN)C(F)(F)F)c(=O)c1 |
| InChI | InChI=1S/C11H17F3N4O/c1-3-4-17(2)8-5-10(19)18(16-7-8)9(6-15)11(12,13)14/h5,7,9H,3-4,6,15H2,1-2H3 |
| InChIKey | NUQDSDXOEOOZKA-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one?
The IUPAC name of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one (CID 114393631) is 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one.
What is the SMILES notation for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one?
The canonical SMILES for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one is CCCN(C)c1cnn(C(CN)C(F)(F)F)c(=O)c1.
What is the InChIKey of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one?
The InChIKey is NUQDSDXOEOOZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F3N4O/c1-3-4-17(2)8-5-10(19)18(16-7-8)9(6-15)11(12,13)14/h5,7,9H,3-4,6,15H2,1-2H3.
What are the key properties of 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one?
2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one has a molecular weight of 278.28 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,1,1-trifluoropropan-2-yl)-5-[methyl(propyl)amino]pyridazin-3-one is sourced from PubChem (CID 114393631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).