C12H22N4O2 — CID 114393747
2-(3-amino-2-ethoxypropyl)-5-[ethyl(methyl)amino]pyridazin-3-one (PubChem CID 114393747) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-(3-amino-2-ethoxypropyl)-5-[ethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-(3-amino-2-ethoxypropyl)-5-[ethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114393747 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-(3-amino-2-ethoxypropyl)-5-[ethyl(methyl)amino]pyridazin-3-one |
| SMILES | CCOC(CN)Cn1ncc(N(C)CC)cc1=O |
| InChI | InChI=1S/C12H22N4O2/c1-4-15(3)10-6-12(17)16(14-8-10)9-11(7-13)18-5-2/h6,8,11H,4-5,7,9,13H2,1-3H3 |
| InChIKey | BBJWQAXFCCZRDJ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |