C14H25N3O4 — CID 114396159
2-(2,2-diethoxyethyl)-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (PubChem CID 114396159) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyl)-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-(2,2-diethoxyethyl)-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114396159 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-(2,2-diethoxyethyl)-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| SMILES | CCOC(Cn1ncc(N(C)CCOC)cc1=O)OCC |
| InChI | InChI=1S/C14H25N3O4/c1-5-20-14(21-6-2)11-17-13(18)9-12(10-15-17)16(3)7-8-19-4/h9-10,14H,5-8,11H2,1-4H3 |
| InChIKey | XPGRCUNMLRAWNE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|