C14H27N5O2 — CID 114397564
2-[2-[2-(dimethylamino)ethylamino]ethyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one (PubChem CID 114397564) has the molecular formula C14H27N5O2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-[2-[2-(dimethylamino)ethylamino]ethyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-[2-[2-(dimethylamino)ethylamino]ethyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114397564 |
| Molecular Formula | C14H27N5O2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 2-[2-[2-(dimethylamino)ethylamino]ethyl]-5-[2-methoxyethyl(methyl)amino]pyridazin-3-one |
| SMILES | COCCN(C)c1cnn(CCNCCN(C)C)c(=O)c1 |
| InChI | InChI=1S/C14H27N5O2/c1-17(2)7-5-15-6-8-19-14(20)11-13(12-16-19)18(3)9-10-21-4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | ZMFPIOHUGITLAD-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|