C15H27N5O — CID 114394736
2-[2-(methylamino)pentyl]-5-(4-methylpiperazin-1-yl)pyridazin-3-one (PubChem CID 114394736) has the molecular formula C15H27N5O and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-[2-(methylamino)pentyl]-5-(4-methylpiperazin-1-yl)pyridazin-3-one.
| Compound Name | 2-[2-(methylamino)pentyl]-5-(4-methylpiperazin-1-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 114394736 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 2-[2-(methylamino)pentyl]-5-(4-methylpiperazin-1-yl)pyridazin-3-one |
| SMILES | CCCC(Cn1ncc(N2CCN(C)CC2)cc1=O)NC |
| InChI | InChI=1S/C15H27N5O/c1-4-5-13(16-2)12-20-15(21)10-14(11-17-20)19-8-6-18(3)7-9-19/h10-11,13,16H,4-9,12H2,1-3H3 |
| InChIKey | XWYAONOUWLYUJL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |