C13H22N4OS — CID 114398963
5-(4-methylpiperazin-1-yl)-2-(2-methyl-3-sulfanylpropyl)pyridazin-3-one (PubChem CID 114398963) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-2-(2-methyl-3-sulfanylpropyl)pyridazin-3-one.
| Compound Name | 5-(4-methylpiperazin-1-yl)-2-(2-methyl-3-sulfanylpropyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114398963 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-2-(2-methyl-3-sulfanylpropyl)pyridazin-3-one |
| SMILES | CC(CS)Cn1ncc(N2CCN(C)CC2)cc1=O |
| InChI | InChI=1S/C13H22N4OS/c1-11(10-19)9-17-13(18)7-12(8-14-17)16-5-3-15(2)4-6-16/h7-8,11,19H,3-6,9-10H2,1-2H3 |
| InChIKey | CQXSHYJHPQXBPV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 41.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|