C12H19N3O2S — CID 114398865
2-(2-methyl-3-sulfanylpropyl)-5-morpholin-4-ylpyridazin-3-one (PubChem CID 114398865) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(2-methyl-3-sulfanylpropyl)-5-morpholin-4-ylpyridazin-3-one.
| Compound Name | 2-(2-methyl-3-sulfanylpropyl)-5-morpholin-4-ylpyridazin-3-one |
|---|---|
| PubChem CID | 114398865 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2-methyl-3-sulfanylpropyl)-5-morpholin-4-ylpyridazin-3-one |
| SMILES | CC(CS)Cn1ncc(N2CCOCC2)cc1=O |
| InChI | InChI=1S/C12H19N3O2S/c1-10(9-18)8-15-12(16)6-11(7-13-15)14-2-4-17-5-3-14/h6-7,10,18H,2-5,8-9H2,1H3 |
| InChIKey | HXPDQGNKTXFTLI-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 47.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|