C13H18F2N2O — CID 114394882
[4-[1-(2,5-difluorophenyl)ethyl]morpholin-2-yl]methanamine (PubChem CID 114394882) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is [4-[1-(2,5-difluorophenyl)ethyl]morpholin-2-yl]methanamine.
| Compound Name | [4-[1-(2,5-difluorophenyl)ethyl]morpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114394882 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | [4-[1-(2,5-difluorophenyl)ethyl]morpholin-2-yl]methanamine |
| SMILES | CC(c1cc(F)ccc1F)N1CCOC(CN)C1 |
| InChI | InChI=1S/C13H18F2N2O/c1-9(12-6-10(14)2-3-13(12)15)17-4-5-18-11(7-16)8-17/h2-3,6,9,11H,4-5,7-8,16H2,1H3 |
| InChIKey | MAICDQWFFWBSMA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |